C24H23F5O5S — CID 176635040
2-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 176635040) has the molecular formula C24H23F5O5S and a molecular weight of 518.50 g/mol. Its IUPAC name is 2-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 176635040 |
| Molecular Formula | C24H23F5O5S |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 2-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | CC(C)(C)C1C2c3ccccc3C(c3ccccc32)C1C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C24H23F5O5S/c1-22(2,3)19-17-14-10-6-4-8-12(14)16(13-9-5-7-11-15(13)17)18(19)20(30)34-21(23(25,26)27)24(28,29)35(31,32)33/h4-11,16-19,21H,1-3H3,(H,31,32,33) |
| InChIKey | NRZSYJUOFHCPTN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|