C10H8F5NO5S — CID 129070483
1,1,3,3,3-pentafluoro-2-(phenylcarbamoyloxy)propane-1-sulfonic acid (PubChem CID 129070483) has the molecular formula C10H8F5NO5S and a molecular weight of 349.23 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(phenylcarbamoyloxy)propane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(phenylcarbamoyloxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 129070483 |
| Molecular Formula | C10H8F5NO5S |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(phenylcarbamoyloxy)propane-1-sulfonic acid |
| SMILES | O=C(Nc1ccccc1)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C10H8F5NO5S/c11-9(12,13)7(10(14,15)22(18,19)20)21-8(17)16-6-4-2-1-3-5-6/h1-5,7H,(H,16,17)(H,18,19,20) |
| InChIKey | PSUFQVHVPBLGSU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|