C14H16F3NO4 — CID 162565621
(2S)-2-(phenylcarbamoyloxy)-4-(trifluoromethyl)hexanoic acid (PubChem CID 162565621) has the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. Its IUPAC name is (2S)-2-(phenylcarbamoyloxy)-4-(trifluoromethyl)hexanoic acid.
| Compound Name | (2S)-2-(phenylcarbamoyloxy)-4-(trifluoromethyl)hexanoic acid |
|---|---|
| PubChem CID | 162565621 |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (2S)-2-(phenylcarbamoyloxy)-4-(trifluoromethyl)hexanoic acid |
| SMILES | CCC(C[C@H](OC(=O)Nc1ccccc1)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO4/c1-2-9(14(15,16)17)8-11(12(19)20)22-13(21)18-10-6-4-3-5-7-10/h3-7,9,11H,2,8H2,1H3,(H,18,21)(H,19,20)/t9?,11-/m0/s1 |
| InChIKey | BVKBIFXNJNYSPN-UMJHXOGRSA-N |
| XLogP | 3.67 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |