C14H14F6NO6P — CID 23628806
(Z)-2-dimethoxyphosphoryl-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-hydroxy-N-phenylprop-2-enamide (PubChem CID 23628806) has the molecular formula C14H14F6NO6P and a molecular weight of 437.23 g/mol. Its IUPAC name is (Z)-2-dimethoxyphosphoryl-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-hydroxy-N-phenylprop-2-enamide.
| Compound Name | (Z)-2-dimethoxyphosphoryl-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-hydroxy-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 23628806 |
| Molecular Formula | C14H14F6NO6P |
| Molecular Weight | 437.23 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | (Z)-2-dimethoxyphosphoryl-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-hydroxy-N-phenylprop-2-enamide |
| SMILES | COP(=O)(OC)/C(C(=O)Nc1ccccc1)=C(/O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H14F6NO6P/c1-25-28(24,26-2)9(10(22)21-8-6-4-3-5-7-8)11(23)27-12(13(15,16)17)14(18,19)20/h3-7,12,23H,1-2H3,(H,21,22)/b11-9- |
| InChIKey | VNPRNTXBCNGIQG-LUAWRHEFSA-N |
| XLogP | 4.35 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|