C15H13F6NO5 — CID 11143860
1,1,1,3,3,3-hexafluoropropan-2-yl (Z)-3-hydroxy-3-methoxy-2-[(4-methylphenyl)carbamoyl]prop-2-enoate (PubChem CID 11143860) has the molecular formula C15H13F6NO5 and a molecular weight of 401.26 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (Z)-3-hydroxy-3-methoxy-2-[(4-methylphenyl)carbamoyl]prop-2-enoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (Z)-3-hydroxy-3-methoxy-2-[(4-methylphenyl)carbamoyl]prop-2-enoate |
|---|---|
| PubChem CID | 11143860 |
| Molecular Formula | C15H13F6NO5 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (Z)-3-hydroxy-3-methoxy-2-[(4-methylphenyl)carbamoyl]prop-2-enoate |
| SMILES | CO/C(O)=C(/C(=O)Nc1ccc(C)cc1)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H13F6NO5/c1-7-3-5-8(6-4-7)22-10(23)9(11(24)26-2)12(25)27-13(14(16,17)18)15(19,20)21/h3-6,13,24H,1-2H3,(H,22,23)/b11-9- |
| InChIKey | TWXHTWJVIYHVER-LUAWRHEFSA-N |
| XLogP | 3.39 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|