C27H22F4O5S — CID 176879838
4-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 176879838) has the molecular formula C27H22F4O5S and a molecular weight of 534.53 g/mol. Its IUPAC name is 4-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 176879838 |
| Molecular Formula | C27H22F4O5S |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 4-(16-tert-butyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CC(C)(C)C1C2c3ccccc3C(c3ccccc32)C1C(=O)Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F |
| InChI | InChI=1S/C27H22F4O5S/c1-27(2,3)19-17-14-10-6-4-8-12(14)16(13-9-5-7-11-15(13)17)18(19)26(32)36-24-20(28)22(30)25(37(33,34)35)23(31)21(24)29/h4-11,16-19H,1-3H3,(H,33,34,35) |
| InChIKey | YLZCWFICJLTHCO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|