C30H24F4O7S — CID 176874350
2,3,5,6-tetrafluoro-4-[16-(1-methylcyclopentyl)oxycarbonyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxybenzenesulfonic acid (PubChem CID 176874350) has the molecular formula C30H24F4O7S and a molecular weight of 604.57 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[16-(1-methylcyclopentyl)oxycarbonyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[16-(1-methylcyclopentyl)oxycarbonyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 176874350 |
| Molecular Formula | C30H24F4O7S |
| Molecular Weight | 604.57 g/mol |
| Exact Mass | 604.12 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[16-(1-methylcyclopentyl)oxycarbonyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxybenzenesulfonic acid |
| SMILES | CC1(OC(=O)C2C3c4ccccc4C(c4ccccc43)C2C(=O)Oc2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)CCCC1 |
| InChI | InChI=1S/C30H24F4O7S/c1-30(12-6-7-13-30)41-29(36)21-19-16-10-4-2-8-14(16)18(15-9-3-5-11-17(15)19)20(21)28(35)40-26-22(31)24(33)27(42(37,38)39)25(34)23(26)32/h2-5,8-11,18-21H,6-7,12-13H2,1H3,(H,37,38,39) |
| InChIKey | HPNKGVKLZIFMJL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.57 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|