C28H11Br3F4O7S — CID 176596733
2,3,5,6-tetrafluoro-4-[10-(2,4,6-tribromobenzoyl)oxyanthracene-9-carbonyl]oxybenzenesulfonic acid (PubChem CID 176596733) has the molecular formula C28H11Br3F4O7S and a molecular weight of 807.16 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[10-(2,4,6-tribromobenzoyl)oxyanthracene-9-carbonyl]oxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[10-(2,4,6-tribromobenzoyl)oxyanthracene-9-carbonyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 176596733 |
| Molecular Formula | C28H11Br3F4O7S |
| Molecular Weight | 807.16 g/mol |
| Exact Mass | 803.77 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[10-(2,4,6-tribromobenzoyl)oxyanthracene-9-carbonyl]oxybenzenesulfonic acid |
| SMILES | O=C(Oc1c2ccccc2c(C(=O)Oc2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)c2ccccc12)c1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C28H11Br3F4O7S/c29-11-9-16(30)19(17(31)10-11)28(37)41-24-14-7-3-1-5-12(14)18(13-6-2-4-8-15(13)24)27(36)42-25-20(32)22(34)26(43(38,39)40)23(35)21(25)33/h1-10H,(H,38,39,40) |
| InChIKey | FFQJHIYKRGKBPM-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.16 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|