C22H9Br3F4IO8S- — CID 177090744
2,3,5,6-tetrafluoro-4-[3-iodo-4-[2-(2,4,6-tribromobenzoyl)oxyethoxy]benzoyl]oxybenzenesulfonate (PubChem CID 177090744) has the molecular formula C22H9Br3F4IO8S- and a molecular weight of 875.98 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[3-iodo-4-[2-(2,4,6-tribromobenzoyl)oxyethoxy]benzoyl]oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[3-iodo-4-[2-(2,4,6-tribromobenzoyl)oxyethoxy]benzoyl]oxybenzenesulfonate |
|---|---|
| PubChem CID | 177090744 |
| Molecular Formula | C22H9Br3F4IO8S- |
| Molecular Weight | 875.98 g/mol |
| Exact Mass | 872.66 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[3-iodo-4-[2-(2,4,6-tribromobenzoyl)oxyethoxy]benzoyl]oxybenzenesulfonate |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F)c1ccc(OCCOC(=O)c2c(Br)cc(Br)cc2Br)c(I)c1 |
| InChI | InChI=1S/C22H10Br3F4IO8S/c23-9-6-10(24)14(11(25)7-9)22(32)37-4-3-36-13-2-1-8(5-12(13)30)21(31)38-19-15(26)17(28)20(39(33,34)35)18(29)16(19)27/h1-2,5-7H,3-4H2,(H,33,34,35)/p-1 |
| InChIKey | JHOBMLLPKMTVJA-UHFFFAOYSA-M |
| XLogP | 6.49 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.98 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|