C15H5F4I2O5S- — CID 176607352
4-(4-ethenyl-2,6-diiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 176607352) has the molecular formula C15H5F4I2O5S- and a molecular weight of 627.07 g/mol. Its IUPAC name is 4-(4-ethenyl-2,6-diiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-(4-ethenyl-2,6-diiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 176607352 |
| Molecular Formula | C15H5F4I2O5S- |
| Molecular Weight | 627.07 g/mol |
| Exact Mass | 626.79 |
| IUPAC Name | 4-(4-ethenyl-2,6-diiodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | C=Cc1cc(I)c(C(=O)Oc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)c(I)c1 |
| InChI | InChI=1S/C15H6F4I2O5S/c1-2-5-3-6(20)8(7(21)4-5)15(22)26-13-9(16)11(18)14(27(23,24)25)12(19)10(13)17/h2-4H,1H2,(H,23,24,25)/p-1 |
| InChIKey | CMKQYSUJYRZCEF-UHFFFAOYSA-M |
| XLogP | 4.22 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.07 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|