C15H7F4INO6S- — CID 171721962
4-(3-acetamido-4-iodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 171721962) has the molecular formula C15H7F4INO6S- and a molecular weight of 532.19 g/mol. Its IUPAC name is 4-(3-acetamido-4-iodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-(3-acetamido-4-iodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 171721962 |
| Molecular Formula | C15H7F4INO6S- |
| Molecular Weight | 532.19 g/mol |
| Exact Mass | 531.90 |
| IUPAC Name | 4-(3-acetamido-4-iodobenzoyl)oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | CC(=O)Nc1cc(C(=O)Oc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)ccc1I |
| InChI | InChI=1S/C15H8F4INO6S/c1-5(22)21-8-4-6(2-3-7(8)20)15(23)27-13-9(16)11(18)14(28(24,25)26)12(19)10(13)17/h2-4H,1H3,(H,21,22)(H,24,25,26)/p-1 |
| InChIKey | JJQFCONZQZESBN-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|