C10H7F3INO3 — CID 11845889
methyl 4-iodo-3-[(2,2,2-trifluoroacetyl)amino]benzoate (PubChem CID 11845889) has the molecular formula C10H7F3INO3 and a molecular weight of 373.07 g/mol. Its IUPAC name is methyl 4-iodo-3-[(2,2,2-trifluoroacetyl)amino]benzoate.
| Compound Name | methyl 4-iodo-3-[(2,2,2-trifluoroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 11845889 |
| Molecular Formula | C10H7F3INO3 |
| Molecular Weight | 373.07 g/mol |
| Exact Mass | 372.94 |
| IUPAC Name | methyl 4-iodo-3-[(2,2,2-trifluoroacetyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(I)c(NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7F3INO3/c1-18-8(16)5-2-3-6(14)7(4-5)15-9(17)10(11,12)13/h2-4H,1H3,(H,15,17) |
| InChIKey | DJIMHSXNJBKORQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.07 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|