C12H10F3NO4 — CID 177474866
methyl 4-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]benzoate (PubChem CID 177474866) has the molecular formula C12H10F3NO4 and a molecular weight of 289.21 g/mol. Its IUPAC name is methyl 4-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]benzoate.
| Compound Name | methyl 4-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]benzoate |
|---|---|
| PubChem CID | 177474866 |
| Molecular Formula | C12H10F3NO4 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | methyl 4-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)CNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F3NO4/c1-20-10(18)8-4-2-7(3-5-8)9(17)6-16-11(19)12(13,14)15/h2-5H,6H2,1H3,(H,16,19) |
| InChIKey | CUTNVYPITXLURK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |