C14H16F3NO3 — CID 129218173
tert-butyl 4-[[(2,2,2-trifluoroacetyl)amino]methyl]benzoate (PubChem CID 129218173) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is tert-butyl 4-[[(2,2,2-trifluoroacetyl)amino]methyl]benzoate.
| Compound Name | tert-butyl 4-[[(2,2,2-trifluoroacetyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 129218173 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | tert-butyl 4-[[(2,2,2-trifluoroacetyl)amino]methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(CNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F3NO3/c1-13(2,3)21-11(19)10-6-4-9(5-7-10)8-18-12(20)14(15,16)17/h4-7H,8H2,1-3H3,(H,18,20) |
| InChIKey | GJLSSPZGEMTJBO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |