C11H11F3N2O3 — CID 118941389
[[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methylamino] formate (PubChem CID 118941389) has the molecular formula C11H11F3N2O3 and a molecular weight of 276.21 g/mol. Its IUPAC name is [[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methylamino] formate.
| Compound Name | [[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methylamino] formate |
|---|---|
| PubChem CID | 118941389 |
| Molecular Formula | C11H11F3N2O3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | [[4-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]methylamino] formate |
| SMILES | O=CONCc1ccc(CNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F3N2O3/c12-11(13,14)10(18)15-5-8-1-3-9(4-2-8)6-16-19-7-17/h1-4,7,16H,5-6H2,(H,15,18) |
| InChIKey | ZZHKRELHGNEMTN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|