C26H26F3NO2 — CID 67188113
tert-butyl 4-[4-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]phenyl]benzoate (PubChem CID 67188113) has the molecular formula C26H26F3NO2 and a molecular weight of 441.49 g/mol. Its IUPAC name is tert-butyl 4-[4-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 4-[4-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 67188113 |
| Molecular Formula | C26H26F3NO2 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | tert-butyl 4-[4-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]phenyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2ccc(CNCc3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H26F3NO2/c1-25(2,3)32-24(31)22-12-10-21(11-13-22)20-8-4-18(5-9-20)16-30-17-19-6-14-23(15-7-19)26(27,28)29/h4-15,30H,16-17H2,1-3H3 |
| InChIKey | LTRDUTNLNZJADZ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |