C8H4ClF3INO — CID 87693092
N-(5-chloro-2-iodophenyl)-2,2,2-trifluoroacetamide (PubChem CID 87693092) has the molecular formula C8H4ClF3INO and a molecular weight of 349.48 g/mol. Its IUPAC name is N-(5-chloro-2-iodophenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(5-chloro-2-iodophenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 87693092 |
| Molecular Formula | C8H4ClF3INO |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 348.90 |
| IUPAC Name | N-(5-chloro-2-iodophenyl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1cc(Cl)ccc1I)C(F)(F)F |
| InChI | InChI=1S/C8H4ClF3INO/c9-4-1-2-5(13)6(3-4)14-7(15)8(10,11)12/h1-3H,(H,14,15) |
| InChIKey | HCAJAQUMJOSQSQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|