C8H3Cl2F3INO — CID 162537552
N-(3,5-dichloro-2-iodophenyl)-2,2,2-trifluoroacetamide (PubChem CID 162537552) has the molecular formula C8H3Cl2F3INO and a molecular weight of 383.92 g/mol. Its IUPAC name is N-(3,5-dichloro-2-iodophenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(3,5-dichloro-2-iodophenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 162537552 |
| Molecular Formula | C8H3Cl2F3INO |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 382.86 |
| IUPAC Name | N-(3,5-dichloro-2-iodophenyl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1I)C(F)(F)F |
| InChI | InChI=1S/C8H3Cl2F3INO/c9-3-1-4(10)6(14)5(2-3)15-7(16)8(11,12)13/h1-2H,(H,15,16) |
| InChIKey | OSNYFVYERGIEAF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|