C9H6BrClF3NO — CID 129147318
N-(5-bromo-4-chloro-2-methylphenyl)-2,2,2-trifluoroacetamide (PubChem CID 129147318) has the molecular formula C9H6BrClF3NO and a molecular weight of 316.50 g/mol. Its IUPAC name is N-(5-bromo-4-chloro-2-methylphenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(5-bromo-4-chloro-2-methylphenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 129147318 |
| Molecular Formula | C9H6BrClF3NO |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 314.93 |
| IUPAC Name | N-(5-bromo-4-chloro-2-methylphenyl)-2,2,2-trifluoroacetamide |
| SMILES | Cc1cc(Cl)c(Br)cc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H6BrClF3NO/c1-4-2-6(11)5(10)3-7(4)15-8(16)9(12,13)14/h2-3H,1H3,(H,15,16) |
| InChIKey | AJQPCNMABQJNPW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |