C8H3Br2F4NO — CID 125116732
N-(3,5-dibromo-2-fluorophenyl)-2,2,2-trifluoroacetamide (PubChem CID 125116732) has the molecular formula C8H3Br2F4NO and a molecular weight of 364.92 g/mol. Its IUPAC name is N-(3,5-dibromo-2-fluorophenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(3,5-dibromo-2-fluorophenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 125116732 |
| Molecular Formula | C8H3Br2F4NO |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 362.85 |
| IUPAC Name | N-(3,5-dibromo-2-fluorophenyl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1cc(Br)cc(Br)c1F)C(F)(F)F |
| InChI | InChI=1S/C8H3Br2F4NO/c9-3-1-4(10)6(11)5(2-3)15-7(16)8(12,13)14/h1-2H,(H,15,16) |
| InChIKey | YDTIBDLYCFSVBY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|