C11H13Cl2NO2 — CID 103891250
N-(3,5-dichloro-2-hydroxyphenyl)-2,2-dimethylpropanamide (PubChem CID 103891250) has the molecular formula C11H13Cl2NO2 and a molecular weight of 262.14 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxyphenyl)-2,2-dimethylpropanamide.
| Compound Name | N-(3,5-dichloro-2-hydroxyphenyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 103891250 |
| Molecular Formula | C11H13Cl2NO2 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxyphenyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C11H13Cl2NO2/c1-11(2,3)10(16)14-8-5-6(12)4-7(13)9(8)15/h4-5,15H,1-3H3,(H,14,16) |
| InChIKey | NPDWSOFTFOEZMJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|