C11H15BClNO3 — CID 154729958
[4-chloro-2-(2,2-dimethylpropanoylamino)phenyl]boronic acid (PubChem CID 154729958) has the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. Its IUPAC name is [4-chloro-2-(2,2-dimethylpropanoylamino)phenyl]boronic acid.
| Compound Name | [4-chloro-2-(2,2-dimethylpropanoylamino)phenyl]boronic acid |
|---|---|
| PubChem CID | 154729958 |
| Molecular Formula | C11H15BClNO3 |
| Molecular Weight | 255.51 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | [4-chloro-2-(2,2-dimethylpropanoylamino)phenyl]boronic acid |
| SMILES | CC(C)(C)C(=O)Nc1cc(Cl)ccc1B(O)O |
| InChI | InChI=1S/C11H15BClNO3/c1-11(2,3)10(15)14-9-6-7(13)4-5-8(9)12(16)17/h4-6,16-17H,1-3H3,(H,14,15) |
| InChIKey | DPDQOYBRNGGUJE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.51 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|