C11H13BClNO3 — CID 164645579
[4-chloro-2-[(2-cyclopropylacetyl)amino]phenyl]boronic acid (PubChem CID 164645579) has the molecular formula C11H13BClNO3 and a molecular weight of 253.49 g/mol. Its IUPAC name is [4-chloro-2-[(2-cyclopropylacetyl)amino]phenyl]boronic acid.
| Compound Name | [4-chloro-2-[(2-cyclopropylacetyl)amino]phenyl]boronic acid |
|---|---|
| PubChem CID | 164645579 |
| Molecular Formula | C11H13BClNO3 |
| Molecular Weight | 253.49 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | [4-chloro-2-[(2-cyclopropylacetyl)amino]phenyl]boronic acid |
| SMILES | O=C(CC1CC1)Nc1cc(Cl)ccc1B(O)O |
| InChI | InChI=1S/C11H13BClNO3/c13-8-3-4-9(12(16)17)10(6-8)14-11(15)5-7-1-2-7/h3-4,6-7,16-17H,1-2,5H2,(H,14,15) |
| InChIKey | IGWGMTTWHUMGEI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.49 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|