5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid

C9H4ClF3INO3 — CID 167721321

IUPAC5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid
SMILESO=C(O)c1cc(Cl)cc(I)c1NC(=O)C(F)(F)F
InChIInChI=1S/C9H4ClF3INO3/c10-3-1-4(7(16)17)6(5(14)2-3)15-8(18)9(11,12)13/h1-2H,(H,15,18)(H,16,17)
InChIKeyCKJYBJJILULOHS-UHFFFAOYSA-N
MW393.49 g/mol
LogP3.14
Rot. Bonds2

About 5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid

5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid (PubChem CID 167721321) has the molecular formula C9H4ClF3INO3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid.

Molecular Properties

Compound Name5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid
PubChem CID167721321
Molecular FormulaC9H4ClF3INO3
Molecular Weight393.49 g/mol
Exact Mass392.89
IUPAC Name5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid
SMILESO=C(O)c1cc(Cl)cc(I)c1NC(=O)C(F)(F)F
InChIInChI=1S/C9H4ClF3INO3/c10-3-1-4(7(16)17)6(5(14)2-3)15-8(18)9(11,12)13/h1-2H,(H,15,18)(H,16,17)
InChIKeyCKJYBJJILULOHS-UHFFFAOYSA-N
XLogP3.14
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500393.49
LogP ≤ 53.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid?
The IUPAC name of 5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid (CID 167721321) is 5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid.
What is the SMILES notation for 5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid?
The canonical SMILES for 5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid is O=C(O)c1cc(Cl)cc(I)c1NC(=O)C(F)(F)F.
What is the InChIKey of 5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid?
The InChIKey is CKJYBJJILULOHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4ClF3INO3/c10-3-1-4(7(16)17)6(5(14)2-3)15-8(18)9(11,12)13/h1-2H,(H,15,18)(H,16,17).
What are the key properties of 5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid?
5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid has a molecular weight of 393.49 g/mol, XLogP of 3.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-iodo-2-[(2,2,2-trifluoroacetyl)amino]benzoic acid is sourced from PubChem (CID 167721321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).