C9H4F3N3O7 — CID 10019069
3,5-dinitro-4-[(2,2,2-trifluoroacetyl)amino]benzoic acid (PubChem CID 10019069) has the molecular formula C9H4F3N3O7 and a molecular weight of 323.14 g/mol. Its IUPAC name is 3,5-dinitro-4-[(2,2,2-trifluoroacetyl)amino]benzoic acid.
| Compound Name | 3,5-dinitro-4-[(2,2,2-trifluoroacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 10019069 |
| Molecular Formula | C9H4F3N3O7 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 3,5-dinitro-4-[(2,2,2-trifluoroacetyl)amino]benzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])c(NC(=O)C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H4F3N3O7/c10-9(11,12)8(18)13-6-4(14(19)20)1-3(7(16)17)2-5(6)15(21)22/h1-2H,(H,13,18)(H,16,17) |
| InChIKey | DGSWKEFDOJITKM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|