C26H16F10N6O6 — CID 159838646
N-[4,8-difluoro-5-(methylamino)-2,6-dinitronaphthalen-1-yl]-2,2,2-trifluoroacetamide;N-[4,8-difluoro-5-(methylamino)naphthalen-1-yl]-2,2,2-trifluoroacetamide (PubChem CID 159838646) has the molecular formula C26H16F10N6O6 and a molecular weight of 698.43 g/mol. Its IUPAC name is N-[4,8-difluoro-5-(methylamino)-2,6-dinitronaphthalen-1-yl]-2,2,2-trifluoroacetamide;N-[4,8-difluoro-5-(methylamino)naphthalen-1-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4,8-difluoro-5-(methylamino)-2,6-dinitronaphthalen-1-yl]-2,2,2-trifluoroacetamide;N-[4,8-difluoro-5-(methylamino)naphthalen-1-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 159838646 |
| Molecular Formula | C26H16F10N6O6 |
| Molecular Weight | 698.43 g/mol |
| Exact Mass | 698.10 |
| IUPAC Name | N-[4,8-difluoro-5-(methylamino)-2,6-dinitronaphthalen-1-yl]-2,2,2-trifluoroacetamide;N-[4,8-difluoro-5-(methylamino)naphthalen-1-yl]-2,2,2-trifluoroacetamide |
| SMILES | CNc1c([N+](=O)[O-])cc(F)c2c(NC(=O)C(F)(F)F)c([N+](=O)[O-])cc(F)c12.CNc1ccc(F)c2c(NC(=O)C(F)(F)F)ccc(F)c12 |
| InChI | InChI=1S/C13H7F5N4O5.C13H9F5N2O/c1-19-10-6(21(24)25)2-5(15)9-8(10)4(14)3-7(22(26)27)11(9)20-12(23)13(16,17)18;1-19-8-4-2-7(15)11-9(5-3-6(14)10(8)11)20-12(21)13(16,17)18/h2-3,19H,1H3,(H,20,23);2-5,19H,1H3,(H,20,21) |
| InChIKey | NOKBNYUUQRRWOB-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 168.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.43 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|