C14H9F3N4O3 — CID 555918
2,2,2-trifluoro-N-(2-nitro-4-phenyldiazenylphenyl)acetamide (PubChem CID 555918) has the molecular formula C14H9F3N4O3 and a molecular weight of 338.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-nitro-4-phenyldiazenylphenyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(2-nitro-4-phenyldiazenylphenyl)acetamide |
|---|---|
| PubChem CID | 555918 |
| Molecular Formula | C14H9F3N4O3 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-nitro-4-phenyldiazenylphenyl)acetamide |
| SMILES | O=C(Nc1ccc(/N=N/c2ccccc2)cc1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C14H9F3N4O3/c15-14(16,17)13(22)18-11-7-6-10(8-12(11)21(23)24)20-19-9-4-2-1-3-5-9/h1-8H,(H,18,22)/b20-19+ |
| InChIKey | RLDAOJLLHFROTK-FMQUCBEESA-N |
| XLogP | 4.51 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|