C20H15F3N4O4 — CID 19038210
3-[3-nitro-4-[(2,2,2-trifluoroacetyl)amino]phenyl]-N-quinolin-3-ylpropanamide (PubChem CID 19038210) has the molecular formula C20H15F3N4O4 and a molecular weight of 432.36 g/mol. Its IUPAC name is 3-[3-nitro-4-[(2,2,2-trifluoroacetyl)amino]phenyl]-N-quinolin-3-ylpropanamide.
| Compound Name | 3-[3-nitro-4-[(2,2,2-trifluoroacetyl)amino]phenyl]-N-quinolin-3-ylpropanamide |
|---|---|
| PubChem CID | 19038210 |
| Molecular Formula | C20H15F3N4O4 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 3-[3-nitro-4-[(2,2,2-trifluoroacetyl)amino]phenyl]-N-quinolin-3-ylpropanamide |
| SMILES | O=C(CCc1ccc(NC(=O)C(F)(F)F)c([N+](=O)[O-])c1)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C20H15F3N4O4/c21-20(22,23)19(29)26-16-7-5-12(9-17(16)27(30)31)6-8-18(28)25-14-10-13-3-1-2-4-15(13)24-11-14/h1-5,7,9-11H,6,8H2,(H,25,28)(H,26,29) |
| InChIKey | HMPPYYDIZUFFDI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|