C24H29N3O — CID 66815460
3-[4-[methyl(pentyl)amino]phenyl]-N-quinolin-3-ylpropanamide (PubChem CID 66815460) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 3-[4-[methyl(pentyl)amino]phenyl]-N-quinolin-3-ylpropanamide.
| Compound Name | 3-[4-[methyl(pentyl)amino]phenyl]-N-quinolin-3-ylpropanamide |
|---|---|
| PubChem CID | 66815460 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 3-[4-[methyl(pentyl)amino]phenyl]-N-quinolin-3-ylpropanamide |
| SMILES | CCCCCN(C)c1ccc(CCC(=O)Nc2cnc3ccccc3c2)cc1 |
| InChI | InChI=1S/C24H29N3O/c1-3-4-7-16-27(2)22-13-10-19(11-14-22)12-15-24(28)26-21-17-20-8-5-6-9-23(20)25-18-21/h5-6,8-11,13-14,17-18H,3-4,7,12,15-16H2,1-2H3,(H,26,28) |
| InChIKey | YJQDIYGFOIDCJI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|