C8H3F5N2O3 — CID 81313213
N-(2,4-difluoro-6-nitrophenyl)-2,2,2-trifluoroacetamide (PubChem CID 81313213) has the molecular formula C8H3F5N2O3 and a molecular weight of 270.11 g/mol. Its IUPAC name is N-(2,4-difluoro-6-nitrophenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2,4-difluoro-6-nitrophenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 81313213 |
| Molecular Formula | C8H3F5N2O3 |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | N-(2,4-difluoro-6-nitrophenyl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1c(F)cc(F)cc1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C8H3F5N2O3/c9-3-1-4(10)6(5(2-3)15(17)18)14-7(16)8(11,12)13/h1-2H,(H,14,16) |
| InChIKey | DQEIAWVXFVUHGG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|