C9H5F2N5O4 — CID 81310187
4-amino-N-(2,4-difluoro-6-nitrophenyl)-1,2,5-oxadiazole-3-carboxamide (PubChem CID 81310187) has the molecular formula C9H5F2N5O4 and a molecular weight of 285.17 g/mol. Its IUPAC name is 4-amino-N-(2,4-difluoro-6-nitrophenyl)-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-(2,4-difluoro-6-nitrophenyl)-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 81310187 |
| Molecular Formula | C9H5F2N5O4 |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 4-amino-N-(2,4-difluoro-6-nitrophenyl)-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)Nc1c(F)cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H5F2N5O4/c10-3-1-4(11)6(5(2-3)16(18)19)13-9(17)7-8(12)15-20-14-7/h1-2H,(H2,12,15)(H,13,17) |
| InChIKey | UMHRJUUAUYOEMH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|