C11H11BrF2N2O3 — CID 81309901
2-bromo-N-(2,4-difluoro-6-nitrophenyl)-3-methylbutanamide (PubChem CID 81309901) has the molecular formula C11H11BrF2N2O3 and a molecular weight of 337.12 g/mol. Its IUPAC name is 2-bromo-N-(2,4-difluoro-6-nitrophenyl)-3-methylbutanamide.
| Compound Name | 2-bromo-N-(2,4-difluoro-6-nitrophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 81309901 |
| Molecular Formula | C11H11BrF2N2O3 |
| Molecular Weight | 337.12 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 2-bromo-N-(2,4-difluoro-6-nitrophenyl)-3-methylbutanamide |
| SMILES | CC(C)C(Br)C(=O)Nc1c(F)cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11BrF2N2O3/c1-5(2)9(12)11(17)15-10-7(14)3-6(13)4-8(10)16(18)19/h3-5,9H,1-2H3,(H,15,17) |
| InChIKey | OEOFBGZKGKYQOQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.12 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|