C8H7F2N3O3 — CID 81310994
2-amino-N-(2,4-difluoro-6-nitrophenyl)acetamide (PubChem CID 81310994) has the molecular formula C8H7F2N3O3 and a molecular weight of 231.16 g/mol. Its IUPAC name is 2-amino-N-(2,4-difluoro-6-nitrophenyl)acetamide.
| Compound Name | 2-amino-N-(2,4-difluoro-6-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 81310994 |
| Molecular Formula | C8H7F2N3O3 |
| Molecular Weight | 231.16 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-amino-N-(2,4-difluoro-6-nitrophenyl)acetamide |
| SMILES | NCC(=O)Nc1c(F)cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7F2N3O3/c9-4-1-5(10)8(12-7(14)3-11)6(2-4)13(15)16/h1-2H,3,11H2,(H,12,14) |
| InChIKey | QXGXTTXDAMUMLJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|