C15H11ClINO4 — CID 167716763
5-chloro-3-iodo-2-(phenylmethoxycarbonylamino)benzoic acid (PubChem CID 167716763) has the molecular formula C15H11ClINO4 and a molecular weight of 431.61 g/mol. Its IUPAC name is 5-chloro-3-iodo-2-(phenylmethoxycarbonylamino)benzoic acid.
| Compound Name | 5-chloro-3-iodo-2-(phenylmethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 167716763 |
| Molecular Formula | C15H11ClINO4 |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 430.94 |
| IUPAC Name | 5-chloro-3-iodo-2-(phenylmethoxycarbonylamino)benzoic acid |
| SMILES | O=C(Nc1c(I)cc(Cl)cc1C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C15H11ClINO4/c16-10-6-11(14(19)20)13(12(17)7-10)18-15(21)22-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,18,21)(H,19,20) |
| InChIKey | GBBVFGTUFYIOPI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|