C15H13ClN2O4 — CID 20636250
5-amino-2-chloro-4-(phenylmethoxycarbonylamino)benzoic acid (PubChem CID 20636250) has the molecular formula C15H13ClN2O4 and a molecular weight of 320.73 g/mol. Its IUPAC name is 5-amino-2-chloro-4-(phenylmethoxycarbonylamino)benzoic acid.
| Compound Name | 5-amino-2-chloro-4-(phenylmethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 20636250 |
| Molecular Formula | C15H13ClN2O4 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 5-amino-2-chloro-4-(phenylmethoxycarbonylamino)benzoic acid |
| SMILES | Nc1cc(C(=O)O)c(Cl)cc1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H13ClN2O4/c16-11-7-13(12(17)6-10(11)14(19)20)18-15(21)22-8-9-4-2-1-3-5-9/h1-7H,8,17H2,(H,18,21)(H,19,20) |
| InChIKey | YQNJFIUPCALBKA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|