C14H4F5I2O6S- — CID 177131404
2,6-diiodo-3-methoxy-4-(2,3,4,5,6-pentafluorophenoxy)carbonylbenzenesulfonate (PubChem CID 177131404) has the molecular formula C14H4F5I2O6S- and a molecular weight of 649.04 g/mol. Its IUPAC name is 2,6-diiodo-3-methoxy-4-(2,3,4,5,6-pentafluorophenoxy)carbonylbenzenesulfonate.
| Compound Name | 2,6-diiodo-3-methoxy-4-(2,3,4,5,6-pentafluorophenoxy)carbonylbenzenesulfonate |
|---|---|
| PubChem CID | 177131404 |
| Molecular Formula | C14H4F5I2O6S- |
| Molecular Weight | 649.04 g/mol |
| Exact Mass | 648.77 |
| IUPAC Name | 2,6-diiodo-3-methoxy-4-(2,3,4,5,6-pentafluorophenoxy)carbonylbenzenesulfonate |
| SMILES | COc1c(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc(I)c(S(=O)(=O)[O-])c1I |
| InChI | InChI=1S/C14H5F5I2O6S/c1-26-11-3(2-4(20)13(10(11)21)28(23,24)25)14(22)27-12-8(18)6(16)5(15)7(17)9(12)19/h2H,1H3,(H,23,24,25)/p-1 |
| InChIKey | OGNLDPJHHZZISG-UHFFFAOYSA-M |
| XLogP | 3.72 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.04 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|