C20H4Br3F4I2O7S- — CID 177131500
2,6-diiodo-4-[2,3,4,5-tetrafluoro-6-(2,4,6-tribromophenoxy)carbonylbenzoyl]oxybenzenesulfonate (PubChem CID 177131500) has the molecular formula C20H4Br3F4I2O7S- and a molecular weight of 957.82 g/mol. Its IUPAC name is 2,6-diiodo-4-[2,3,4,5-tetrafluoro-6-(2,4,6-tribromophenoxy)carbonylbenzoyl]oxybenzenesulfonate.
| Compound Name | 2,6-diiodo-4-[2,3,4,5-tetrafluoro-6-(2,4,6-tribromophenoxy)carbonylbenzoyl]oxybenzenesulfonate |
|---|---|
| PubChem CID | 177131500 |
| Molecular Formula | C20H4Br3F4I2O7S- |
| Molecular Weight | 957.82 g/mol |
| Exact Mass | 954.53 |
| IUPAC Name | 2,6-diiodo-4-[2,3,4,5-tetrafluoro-6-(2,4,6-tribromophenoxy)carbonylbenzoyl]oxybenzenesulfonate |
| SMILES | O=C(Oc1cc(I)c(S(=O)(=O)[O-])c(I)c1)c1c(F)c(F)c(F)c(F)c1C(=O)Oc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C20H5Br3F4I2O7S/c21-5-1-7(22)17(8(23)2-5)36-20(31)12-11(13(24)15(26)16(27)14(12)25)19(30)35-6-3-9(28)18(10(29)4-6)37(32,33)34/h1-4H,(H,32,33,34)/p-1 |
| InChIKey | RBKKOSSXTCOGID-UHFFFAOYSA-M |
| XLogP | 7.08 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.82 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|