C20H14Br3I2O7S- — CID 177132001
2,6-diiodo-4-[2-(2,4,6-tribromophenoxy)carbonylcyclohexanecarbonyl]oxybenzenesulfonate (PubChem CID 177132001) has the molecular formula C20H14Br3I2O7S- and a molecular weight of 891.91 g/mol. Its IUPAC name is 2,6-diiodo-4-[2-(2,4,6-tribromophenoxy)carbonylcyclohexanecarbonyl]oxybenzenesulfonate.
| Compound Name | 2,6-diiodo-4-[2-(2,4,6-tribromophenoxy)carbonylcyclohexanecarbonyl]oxybenzenesulfonate |
|---|---|
| PubChem CID | 177132001 |
| Molecular Formula | C20H14Br3I2O7S- |
| Molecular Weight | 891.91 g/mol |
| Exact Mass | 888.61 |
| IUPAC Name | 2,6-diiodo-4-[2-(2,4,6-tribromophenoxy)carbonylcyclohexanecarbonyl]oxybenzenesulfonate |
| SMILES | O=C(Oc1cc(I)c(S(=O)(=O)[O-])c(I)c1)C1CCCCC1C(=O)Oc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C20H15Br3I2O7S/c21-9-5-13(22)17(14(23)6-9)32-20(27)12-4-2-1-3-11(12)19(26)31-10-7-15(24)18(16(25)8-10)33(28,29)30/h5-8,11-12H,1-4H2,(H,28,29,30)/p-1 |
| InChIKey | IEYNLMVJDDXDEB-UHFFFAOYSA-M |
| XLogP | 6.40 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.91 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|