C6H2BrI2O3S- — CID 177131361
4-bromo-2,6-diiodobenzenesulfonate (PubChem CID 177131361) has the molecular formula C6H2BrI2O3S- and a molecular weight of 487.86 g/mol. Its IUPAC name is 4-bromo-2,6-diiodobenzenesulfonate.
| Compound Name | 4-bromo-2,6-diiodobenzenesulfonate |
|---|---|
| PubChem CID | 177131361 |
| Molecular Formula | C6H2BrI2O3S- |
| Molecular Weight | 487.86 g/mol |
| Exact Mass | 486.70 |
| IUPAC Name | 4-bromo-2,6-diiodobenzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(I)cc(Br)cc1I |
| InChI | InChI=1S/C6H3BrI2O3S/c7-3-1-4(8)6(5(9)2-3)13(10,11)12/h1-2H,(H,10,11,12)/p-1 |
| InChIKey | CUHADRKYFRNJJI-UHFFFAOYSA-M |
| XLogP | 2.56 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.86 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|