C16H6Cl2I3O7S- — CID 177131562
4-[(Z)-2,3-dichloro-4-(4-iodophenoxy)-4-oxobut-2-enoyl]oxy-2,6-diiodobenzenesulfonate (PubChem CID 177131562) has the molecular formula C16H6Cl2I3O7S- and a molecular weight of 793.90 g/mol. Its IUPAC name is 4-[(Z)-2,3-dichloro-4-(4-iodophenoxy)-4-oxobut-2-enoyl]oxy-2,6-diiodobenzenesulfonate.
| Compound Name | 4-[(Z)-2,3-dichloro-4-(4-iodophenoxy)-4-oxobut-2-enoyl]oxy-2,6-diiodobenzenesulfonate |
|---|---|
| PubChem CID | 177131562 |
| Molecular Formula | C16H6Cl2I3O7S- |
| Molecular Weight | 793.90 g/mol |
| Exact Mass | 792.64 |
| IUPAC Name | 4-[(Z)-2,3-dichloro-4-(4-iodophenoxy)-4-oxobut-2-enoyl]oxy-2,6-diiodobenzenesulfonate |
| SMILES | O=C(Oc1ccc(I)cc1)/C(Cl)=C(/Cl)C(=O)Oc1cc(I)c(S(=O)(=O)[O-])c(I)c1 |
| InChI | InChI=1S/C16H7Cl2I3O7S/c17-12(15(22)27-8-3-1-7(19)2-4-8)13(18)16(23)28-9-5-10(20)14(11(21)6-9)29(24,25)26/h1-6H,(H,24,25,26)/p-1/b13-12- |
| InChIKey | PQPCOMHJBCGOKB-SEYXRHQNSA-M |
| XLogP | 4.60 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|