C13H6I3O5S- — CID 170531204
4-(2,4,6-triiodobenzoyl)oxybenzenesulfonate (PubChem CID 170531204) has the molecular formula C13H6I3O5S- and a molecular weight of 654.97 g/mol. Its IUPAC name is 4-(2,4,6-triiodobenzoyl)oxybenzenesulfonate.
| Compound Name | 4-(2,4,6-triiodobenzoyl)oxybenzenesulfonate |
|---|---|
| PubChem CID | 170531204 |
| Molecular Formula | C13H6I3O5S- |
| Molecular Weight | 654.97 g/mol |
| Exact Mass | 654.71 |
| IUPAC Name | 4-(2,4,6-triiodobenzoyl)oxybenzenesulfonate |
| SMILES | O=C(Oc1ccc(S(=O)(=O)[O-])cc1)c1c(I)cc(I)cc1I |
| InChI | InChI=1S/C13H7I3O5S/c14-7-5-10(15)12(11(16)6-7)13(17)21-8-1-3-9(4-2-8)22(18,19)20/h1-6H,(H,18,19,20)/p-1 |
| InChIKey | ICLHTNFUGCJFGZ-UHFFFAOYSA-M |
| XLogP | 3.62 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.97 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|