C15H7I4O7S- — CID 170531246
4-[2-(2,3,4,5-tetraiodobenzoyl)oxyacetyl]oxybenzenesulfonate (PubChem CID 170531246) has the molecular formula C15H7I4O7S- and a molecular weight of 838.90 g/mol. Its IUPAC name is 4-[2-(2,3,4,5-tetraiodobenzoyl)oxyacetyl]oxybenzenesulfonate.
| Compound Name | 4-[2-(2,3,4,5-tetraiodobenzoyl)oxyacetyl]oxybenzenesulfonate |
|---|---|
| PubChem CID | 170531246 |
| Molecular Formula | C15H7I4O7S- |
| Molecular Weight | 838.90 g/mol |
| Exact Mass | 838.61 |
| IUPAC Name | 4-[2-(2,3,4,5-tetraiodobenzoyl)oxyacetyl]oxybenzenesulfonate |
| SMILES | O=C(COC(=O)c1cc(I)c(I)c(I)c1I)Oc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C15H8I4O7S/c16-10-5-9(12(17)14(19)13(10)18)15(21)25-6-11(20)26-7-1-3-8(4-2-7)27(22,23)24/h1-5H,6H2,(H,22,23,24)/p-1 |
| InChIKey | NEWODZXAVGAUKG-UHFFFAOYSA-M |
| XLogP | 3.77 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.90 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|