C15H10I2O7S — CID 170531291
4-[2-(2,5-diiodobenzoyl)oxyacetyl]oxybenzenesulfonic acid (PubChem CID 170531291) has the molecular formula C15H10I2O7S and a molecular weight of 588.11 g/mol. Its IUPAC name is 4-[2-(2,5-diiodobenzoyl)oxyacetyl]oxybenzenesulfonic acid.
| Compound Name | 4-[2-(2,5-diiodobenzoyl)oxyacetyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 170531291 |
| Molecular Formula | C15H10I2O7S |
| Molecular Weight | 588.11 g/mol |
| Exact Mass | 587.82 |
| IUPAC Name | 4-[2-(2,5-diiodobenzoyl)oxyacetyl]oxybenzenesulfonic acid |
| SMILES | O=C(COC(=O)c1cc(I)ccc1I)Oc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H10I2O7S/c16-9-1-6-13(17)12(7-9)15(19)23-8-14(18)24-10-2-4-11(5-3-10)25(20,21)22/h1-7H,8H2,(H,20,21,22) |
| InChIKey | MUZRSSVBIWQDSZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.11 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|