C14H8I3O5S- — CID 153471808
3-methyl-4-(2,3,5-triiodobenzoyl)oxybenzenesulfonate (PubChem CID 153471808) has the molecular formula C14H8I3O5S- and a molecular weight of 668.99 g/mol. Its IUPAC name is 3-methyl-4-(2,3,5-triiodobenzoyl)oxybenzenesulfonate.
| Compound Name | 3-methyl-4-(2,3,5-triiodobenzoyl)oxybenzenesulfonate |
|---|---|
| PubChem CID | 153471808 |
| Molecular Formula | C14H8I3O5S- |
| Molecular Weight | 668.99 g/mol |
| Exact Mass | 668.72 |
| IUPAC Name | 3-methyl-4-(2,3,5-triiodobenzoyl)oxybenzenesulfonate |
| SMILES | Cc1cc(S(=O)(=O)[O-])ccc1OC(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C14H9I3O5S/c1-7-4-9(23(19,20)21)2-3-12(7)22-14(18)10-5-8(15)6-11(16)13(10)17/h2-6H,1H3,(H,19,20,21)/p-1 |
| InChIKey | YFIYBHVLJUAWAY-UHFFFAOYSA-M |
| XLogP | 3.93 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.99 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|