C24H11F4I3O4P3S- — CID 171721937
[bis-phosphanylidene-[2,3,5,6-tetrafluoro-4-[4-(2,3,5-triiodobenzoyl)oxynaphthalene-1-carbonyl]oxyphenyl]-λ6-sulfanyl]phosphanide (PubChem CID 171721937) has the molecular formula C24H11F4I3O4P3S- and a molecular weight of 945.04 g/mol. Its IUPAC name is [bis-phosphanylidene-[2,3,5,6-tetrafluoro-4-[4-(2,3,5-triiodobenzoyl)oxynaphthalene-1-carbonyl]oxyphenyl]-λ6-sulfanyl]phosphanide.
| Compound Name | [bis-phosphanylidene-[2,3,5,6-tetrafluoro-4-[4-(2,3,5-triiodobenzoyl)oxynaphthalene-1-carbonyl]oxyphenyl]-λ6-sulfanyl]phosphanide |
|---|---|
| PubChem CID | 171721937 |
| Molecular Formula | C24H11F4I3O4P3S- |
| Molecular Weight | 945.04 g/mol |
| Exact Mass | 944.67 |
| IUPAC Name | [bis-phosphanylidene-[2,3,5,6-tetrafluoro-4-[4-(2,3,5-triiodobenzoyl)oxynaphthalene-1-carbonyl]oxyphenyl]-λ6-sulfanyl]phosphanide |
| SMILES | [H]P=S([PH-])(=P[H])c1c(F)c(F)c(OC(=O)c2ccc(OC(=O)c3cc(I)cc(I)c3I)c3ccccc23)c(F)c1F |
| InChI | InChI=1S/C24H11F4I3O4P3S/c25-16-18(27)22(39(36,37)38)19(28)17(26)21(16)35-23(32)12-5-6-15(11-4-2-1-3-10(11)12)34-24(33)13-7-9(29)8-14(30)20(13)31/h1-8,36-38H/q-1 |
| InChIKey | CXNVHDVAZXTZHS-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.04 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|