C25H11F4I3O6S — CID 176596858
2,3,5,6-tetrafluoro-4-[2-oxo-2-[3-(2,4,6-triiodophenoxy)carbonylnaphthalen-2-yl]ethyl]benzenesulfonic acid (PubChem CID 176596858) has the molecular formula C25H11F4I3O6S and a molecular weight of 896.13 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2-oxo-2-[3-(2,4,6-triiodophenoxy)carbonylnaphthalen-2-yl]ethyl]benzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2-oxo-2-[3-(2,4,6-triiodophenoxy)carbonylnaphthalen-2-yl]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 176596858 |
| Molecular Formula | C25H11F4I3O6S |
| Molecular Weight | 896.13 g/mol |
| Exact Mass | 895.73 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2-oxo-2-[3-(2,4,6-triiodophenoxy)carbonylnaphthalen-2-yl]ethyl]benzenesulfonic acid |
| SMILES | O=C(Cc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)c1cc2ccccc2cc1C(=O)Oc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C25H11F4I3O6S/c26-19-15(20(27)22(29)24(21(19)28)39(35,36)37)9-18(33)13-5-10-3-1-2-4-11(10)6-14(13)25(34)38-23-16(31)7-12(30)8-17(23)32/h1-8H,9H2,(H,35,36,37) |
| InChIKey | JOFKPRBDSIXLOW-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.13 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|