About (4-chloronaphthalen-1-yl) 2-iodobenzoate
(4-chloronaphthalen-1-yl) 2-iodobenzoate (PubChem CID 7919991) has the molecular formula C17H10ClIO2
and a molecular weight of 408.62 g/mol. Its IUPAC name is (4-chloronaphthalen-1-yl) 2-iodobenzoate.
Molecular Properties
| Compound Name | (4-chloronaphthalen-1-yl) 2-iodobenzoate |
| PubChem CID | 7919991 |
| Molecular Formula | C17H10ClIO2 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | (4-chloronaphthalen-1-yl) 2-iodobenzoate |
| SMILES | O=C(Oc1ccc(Cl)c2ccccc12)c1ccccc1I |
| InChI | InChI=1S/C17H10ClIO2/c18-14-9-10-16(12-6-2-1-5-11(12)14)21-17(20)13-7-3-4-8-15(13)19/h1-10H |
| InChIKey | FSXUPRPWTBGXMG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-chloronaphthalen-1-yl) 2-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloronaphthalen-1-yl) 2-iodobenzoate?
The IUPAC name of (4-chloronaphthalen-1-yl) 2-iodobenzoate (CID 7919991) is (4-chloronaphthalen-1-yl) 2-iodobenzoate.
What is the SMILES notation for (4-chloronaphthalen-1-yl) 2-iodobenzoate?
The canonical SMILES for (4-chloronaphthalen-1-yl) 2-iodobenzoate is O=C(Oc1ccc(Cl)c2ccccc12)c1ccccc1I.
What is the InChIKey of (4-chloronaphthalen-1-yl) 2-iodobenzoate?
The InChIKey is FSXUPRPWTBGXMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10ClIO2/c18-14-9-10-16(12-6-2-1-5-11(12)14)21-17(20)13-7-3-4-8-15(13)19/h1-10H.
What are the key properties of (4-chloronaphthalen-1-yl) 2-iodobenzoate?
(4-chloronaphthalen-1-yl) 2-iodobenzoate has a molecular weight of 408.62 g/mol, XLogP of 5.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloronaphthalen-1-yl) 2-iodobenzoate is sourced from PubChem (CID 7919991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).