C14H8I2O7S — CID 177131225
2,6-diiodo-4-(2-oxo-2-phenoxyacetyl)oxybenzenesulfonic acid (PubChem CID 177131225) has the molecular formula C14H8I2O7S and a molecular weight of 574.09 g/mol. Its IUPAC name is 2,6-diiodo-4-(2-oxo-2-phenoxyacetyl)oxybenzenesulfonic acid.
| Compound Name | 2,6-diiodo-4-(2-oxo-2-phenoxyacetyl)oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 177131225 |
| Molecular Formula | C14H8I2O7S |
| Molecular Weight | 574.09 g/mol |
| Exact Mass | 573.81 |
| IUPAC Name | 2,6-diiodo-4-(2-oxo-2-phenoxyacetyl)oxybenzenesulfonic acid |
| SMILES | O=C(Oc1ccccc1)C(=O)Oc1cc(I)c(S(=O)(=O)O)c(I)c1 |
| InChI | InChI=1S/C14H8I2O7S/c15-10-6-9(7-11(16)12(10)24(19,20)21)23-14(18)13(17)22-8-4-2-1-3-5-8/h1-7H,(H,19,20,21) |
| InChIKey | DEUPDCBPNCRJSC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.09 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|