C13H7I3O5S — CID 177131777
2,6-diiodo-4-(3-iodobenzoyl)oxybenzenesulfonic acid (PubChem CID 177131777) has the molecular formula C13H7I3O5S and a molecular weight of 655.97 g/mol. Its IUPAC name is 2,6-diiodo-4-(3-iodobenzoyl)oxybenzenesulfonic acid.
| Compound Name | 2,6-diiodo-4-(3-iodobenzoyl)oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 177131777 |
| Molecular Formula | C13H7I3O5S |
| Molecular Weight | 655.97 g/mol |
| Exact Mass | 655.71 |
| IUPAC Name | 2,6-diiodo-4-(3-iodobenzoyl)oxybenzenesulfonic acid |
| SMILES | O=C(Oc1cc(I)c(S(=O)(=O)O)c(I)c1)c1cccc(I)c1 |
| InChI | InChI=1S/C13H7I3O5S/c14-8-3-1-2-7(4-8)13(17)21-9-5-10(15)12(11(16)6-9)22(18,19)20/h1-6H,(H,18,19,20) |
| InChIKey | GHMAWPNWPDPFDV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.97 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|