C28H12I8O9S — CID 177131831
4-[[3,5-bis[(2,4,6-triiodobenzoyl)oxy]phenyl]methoxycarbonyl]-2,6-diiodobenzenesulfonic acid (PubChem CID 177131831) has the molecular formula C28H12I8O9S and a molecular weight of 1539.69 g/mol. Its IUPAC name is 4-[[3,5-bis[(2,4,6-triiodobenzoyl)oxy]phenyl]methoxycarbonyl]-2,6-diiodobenzenesulfonic acid.
| Compound Name | 4-[[3,5-bis[(2,4,6-triiodobenzoyl)oxy]phenyl]methoxycarbonyl]-2,6-diiodobenzenesulfonic acid |
|---|---|
| PubChem CID | 177131831 |
| Molecular Formula | C28H12I8O9S |
| Molecular Weight | 1539.69 g/mol |
| Exact Mass | 1539.26 |
| IUPAC Name | 4-[[3,5-bis[(2,4,6-triiodobenzoyl)oxy]phenyl]methoxycarbonyl]-2,6-diiodobenzenesulfonic acid |
| SMILES | O=C(OCc1cc(OC(=O)c2c(I)cc(I)cc2I)cc(OC(=O)c2c(I)cc(I)cc2I)c1)c1cc(I)c(S(=O)(=O)O)c(I)c1 |
| InChI | InChI=1S/C28H12I8O9S/c29-13-5-17(31)23(18(32)6-13)27(38)44-15-1-11(2-16(9-15)45-28(39)24-19(33)7-14(30)8-20(24)34)10-43-26(37)12-3-21(35)25(22(36)4-12)46(40,41)42/h1-9H,10H2,(H,40,41,42) |
| InChIKey | IEKRAFITYKRSSF-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1539.69 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|